C19H13ClN2O3 — CID 39860503
(E)-3-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-yl)-1-pyridin-4-ylprop-2-en-1-one (PubChem CID 39860503) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is (E)-3-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-yl)-1-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-yl)-1-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 39860503 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (E)-3-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-8-yl)-1-pyridin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc2cc3c(cc2nc1Cl)OCCO3)c1ccncc1 |
| InChI | InChI=1S/C19H13ClN2O3/c20-19-13(1-2-16(23)12-3-5-21-6-4-12)9-14-10-17-18(11-15(14)22-19)25-8-7-24-17/h1-6,9-11H,7-8H2/b2-1+ |
| InChIKey | RNGTUULBYPHCMV-OWOJBTEDSA-N |
| XLogP | 3.95 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|