C20H15Cl2NO3 — CID 6476747
(E)-3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-1-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 6476747) has the molecular formula C20H15Cl2NO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is (E)-3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-1-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-1-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6476747 |
| Molecular Formula | C20H15Cl2NO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (E)-3-(2-chloro-6,7-dimethoxyquinolin-3-yl)-1-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1cc2cc(/C=C/C(=O)c3ccc(Cl)cc3)c(Cl)nc2cc1OC |
| InChI | InChI=1S/C20H15Cl2NO3/c1-25-18-10-14-9-13(20(22)23-16(14)11-19(18)26-2)5-8-17(24)12-3-6-15(21)7-4-12/h3-11H,1-2H3/b8-5+ |
| InChIKey | IPYTYGYGPSVQDB-VMPITWQZSA-N |
| XLogP | 5.45 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|