C17H15N3O2 — CID 3986900
1-quinoxalin-2-yl-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 3986900) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-quinoxalin-2-yl-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-quinoxalin-2-yl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 3986900 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-quinoxalin-2-yl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)C(c1cnc3ccccc3n1)NCC2 |
| InChI | InChI=1S/C17H15N3O2/c21-15-7-10-5-6-18-17(11(10)8-16(15)22)14-9-19-12-3-1-2-4-13(12)20-14/h1-4,7-9,17-18,21-22H,5-6H2 |
| InChIKey | PKBVOFMIYUOLMU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|