C21H21N5OS — CID 39952254
5-(1,3-benzothiazol-2-yl)-N-[2-(pyridin-4-ylmethyl)pyrazol-3-yl]pentanamide (PubChem CID 39952254) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[2-(pyridin-4-ylmethyl)pyrazol-3-yl]pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[2-(pyridin-4-ylmethyl)pyrazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 39952254 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[2-(pyridin-4-ylmethyl)pyrazol-3-yl]pentanamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)Nc1ccnn1Cc1ccncc1 |
| InChI | InChI=1S/C21H21N5OS/c27-20(7-3-4-8-21-24-17-5-1-2-6-18(17)28-21)25-19-11-14-23-26(19)15-16-9-12-22-13-10-16/h1-2,5-6,9-14H,3-4,7-8,15H2,(H,25,27) |
| InChIKey | FWXYWJQCSIFEBN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|