C19H24N4OS — CID 134013424
5-(1,3-benzothiazol-2-yl)-N-(2-butan-2-ylpyrazol-3-yl)pentanamide (PubChem CID 134013424) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(2-butan-2-ylpyrazol-3-yl)pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(2-butan-2-ylpyrazol-3-yl)pentanamide |
|---|---|
| PubChem CID | 134013424 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(2-butan-2-ylpyrazol-3-yl)pentanamide |
| SMILES | CCC(C)n1nccc1NC(=O)CCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H24N4OS/c1-3-14(2)23-17(12-13-20-23)22-18(24)10-6-7-11-19-21-15-8-4-5-9-16(15)25-19/h4-5,8-9,12-14H,3,6-7,10-11H2,1-2H3,(H,22,24) |
| InChIKey | KZKOVECMMJDCAA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|