C15H13BrN4O5S2 — CID 3996462
N-[[(4-bromophenyl)sulfonylamino]carbamothioyl]-3-methyl-4-nitrobenzamide (PubChem CID 3996462) has the molecular formula C15H13BrN4O5S2 and a molecular weight of 473.33 g/mol. Its IUPAC name is N-[[(4-bromophenyl)sulfonylamino]carbamothioyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[[(4-bromophenyl)sulfonylamino]carbamothioyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 3996462 |
| Molecular Formula | C15H13BrN4O5S2 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 471.95 |
| IUPAC Name | N-[[(4-bromophenyl)sulfonylamino]carbamothioyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NC(=S)NNS(=O)(=O)c2ccc(Br)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13BrN4O5S2/c1-9-8-10(2-7-13(9)20(22)23)14(21)17-15(26)18-19-27(24,25)12-5-3-11(16)4-6-12/h2-8,19H,1H3,(H2,17,18,21,26) |
| InChIKey | IGAGTZRYXPHJFP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|