C20H22N4O3S3 — CID 39965741
N-cyclopropyl-N-[5-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 39965741) has the molecular formula C20H22N4O3S3 and a molecular weight of 462.62 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 39965741 |
| Molecular Formula | C20H22N4O3S3 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-cyclopropyl-N-[5-[[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(SCc2csc(-c3ccc(OC)c(OC)c3)n2)s1)C1CC1 |
| InChI | InChI=1S/C20H22N4O3S3/c1-4-17(25)24(14-6-7-14)19-22-23-20(30-19)29-11-13-10-28-18(21-13)12-5-8-15(26-2)16(9-12)27-3/h5,8-10,14H,4,6-7,11H2,1-3H3 |
| InChIKey | ZVIBKCDENJYSQH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|