C17H17BrClNO4S — CID 39999151
ethyl 3-bromo-4-[(4-chlorophenyl)methyl-methylsulfamoyl]benzoate (PubChem CID 39999151) has the molecular formula C17H17BrClNO4S and a molecular weight of 446.75 g/mol. Its IUPAC name is ethyl 3-bromo-4-[(4-chlorophenyl)methyl-methylsulfamoyl]benzoate.
| Compound Name | ethyl 3-bromo-4-[(4-chlorophenyl)methyl-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 39999151 |
| Molecular Formula | C17H17BrClNO4S |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | ethyl 3-bromo-4-[(4-chlorophenyl)methyl-methylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N(C)Cc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C17H17BrClNO4S/c1-3-24-17(21)13-6-9-16(15(18)10-13)25(22,23)20(2)11-12-4-7-14(19)8-5-12/h4-10H,3,11H2,1-2H3 |
| InChIKey | MFPGOZFHPGBIIA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |