About 4-ethylbenzaldehyde
4-ethylbenzaldehyde (PubChem CID 20861) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-ethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-ethylbenzaldehyde |
| PubChem CID | 20861 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 4-ethylbenzaldehyde |
| SMILES | CCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h3-7H,2H2,1H3 |
| InChIKey | QNGNSVIICDLXHT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzaldehyde?
The IUPAC name of 4-ethylbenzaldehyde (CID 20861) is 4-ethylbenzaldehyde.
What is the SMILES notation for 4-ethylbenzaldehyde?
The canonical SMILES for 4-ethylbenzaldehyde is CCc1ccc(C=O)cc1.
What is the InChIKey of 4-ethylbenzaldehyde?
The InChIKey is QNGNSVIICDLXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h3-7H,2H2,1H3.
What are the key properties of 4-ethylbenzaldehyde?
4-ethylbenzaldehyde has a molecular weight of 134.18 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzaldehyde is sourced from PubChem (CID 20861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).