C18H18BrN3O — CID 4000715
5-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1-methylimidazol-2-amine (PubChem CID 4000715) has the molecular formula C18H18BrN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1-methylimidazol-2-amine.
| Compound Name | 5-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 4000715 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 5-(4-bromophenyl)-N-[(4-methoxyphenyl)methyl]-1-methylimidazol-2-amine |
| SMILES | COc1ccc(CNc2ncc(-c3ccc(Br)cc3)n2C)cc1 |
| InChI | InChI=1S/C18H18BrN3O/c1-22-17(14-5-7-15(19)8-6-14)12-21-18(22)20-11-13-3-9-16(23-2)10-4-13/h3-10,12H,11H2,1-2H3,(H,20,21) |
| InChIKey | NULXCRMNZCSTHR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |