C18H12BrN3O2S — CID 4008365
2-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenoxy]methyl]benzonitrile (PubChem CID 4008365) has the molecular formula C18H12BrN3O2S and a molecular weight of 414.28 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 4008365 |
| Molecular Formula | C18H12BrN3O2S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(C=C2SC(N)=NC2=O)cc1Br |
| InChI | InChI=1S/C18H12BrN3O2S/c19-14-7-11(8-16-17(23)22-18(21)25-16)5-6-15(14)24-10-13-4-2-1-3-12(13)9-20/h1-8H,10H2,(H2,21,22,23) |
| InChIKey | ABRNLGNCVGLZRO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|