C14H18N4OS — CID 4008461
2-(4-tert-butylphenyl)sulfanyl-N-(1,2,4-triazol-4-yl)acetamide (PubChem CID 4008461) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N-(1,2,4-triazol-4-yl)acetamide.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N-(1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 4008461 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N-(1,2,4-triazol-4-yl)acetamide |
| SMILES | CC(C)(C)c1ccc(SCC(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C14H18N4OS/c1-14(2,3)11-4-6-12(7-5-11)20-8-13(19)17-18-9-15-16-10-18/h4-7,9-10H,8H2,1-3H3,(H,17,19) |
| InChIKey | DZNNUSNHMOQMOM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |