C22H27N3O6S — CID 4016740
1-(4-methoxyphenyl)sulfonyl-4-(3,4,5-triethoxyphenyl)pyrazol-3-amine (PubChem CID 4016740) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-4-(3,4,5-triethoxyphenyl)pyrazol-3-amine.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-4-(3,4,5-triethoxyphenyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 4016740 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-4-(3,4,5-triethoxyphenyl)pyrazol-3-amine |
| SMILES | CCOc1cc(-c2cn(S(=O)(=O)c3ccc(OC)cc3)nc2N)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H27N3O6S/c1-5-29-19-12-15(13-20(30-6-2)21(19)31-7-3)18-14-25(24-22(18)23)32(26,27)17-10-8-16(28-4)9-11-17/h8-14H,5-7H2,1-4H3,(H2,23,24) |
| InChIKey | XOPFGBNBQMQCLV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |