C24H37N2O3S+ — CID 4030451
[3-[N-(benzenesulfonyl)-3-methylanilino]-2-hydroxypropyl]-bis(2-methylpropyl)azanium (PubChem CID 4030451) has the molecular formula C24H37N2O3S+ and a molecular weight of 433.64 g/mol. Its IUPAC name is [3-[N-(benzenesulfonyl)-3-methylanilino]-2-hydroxypropyl]-bis(2-methylpropyl)azanium.
| Compound Name | [3-[N-(benzenesulfonyl)-3-methylanilino]-2-hydroxypropyl]-bis(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 4030451 |
| Molecular Formula | C24H37N2O3S+ |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | [3-[N-(benzenesulfonyl)-3-methylanilino]-2-hydroxypropyl]-bis(2-methylpropyl)azanium |
| SMILES | Cc1cccc(N(CC(O)C[NH+](CC(C)C)CC(C)C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H36N2O3S/c1-19(2)15-25(16-20(3)4)17-23(27)18-26(22-11-9-10-21(5)14-22)30(28,29)24-12-7-6-8-13-24/h6-14,19-20,23,27H,15-18H2,1-5H3/p+1 |
| InChIKey | NYRLHVVVDSSCIY-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |