C17H22ClN3O5S — CID 44654735
[3-[N-(benzenesulfonyl)-3-nitroanilino]-2-hydroxypropyl]-dimethylazanium chloride (PubChem CID 44654735) has the molecular formula C17H22ClN3O5S and a molecular weight of 415.90 g/mol. Its IUPAC name is [3-[N-(benzenesulfonyl)-3-nitroanilino]-2-hydroxypropyl]-dimethylazanium chloride.
| Compound Name | [3-[N-(benzenesulfonyl)-3-nitroanilino]-2-hydroxypropyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 44654735 |
| Molecular Formula | C17H22ClN3O5S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [3-[N-(benzenesulfonyl)-3-nitroanilino]-2-hydroxypropyl]-dimethylazanium chloride |
| SMILES | C[NH+](C)CC(O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C17H21N3O5S.ClH/c1-18(2)12-16(21)13-19(14-7-6-8-15(11-14)20(22)23)26(24,25)17-9-4-3-5-10-17;/h3-11,16,21H,12-13H2,1-2H3;1H |
| InChIKey | ZXHIFUJVQROICD-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|