C29H29FN2O2 — CID 4031989
1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methyl-N-(4-phenylbutan-2-yl)pyrrole-3-carboxamide (PubChem CID 4031989) has the molecular formula C29H29FN2O2 and a molecular weight of 456.56 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methyl-N-(4-phenylbutan-2-yl)pyrrole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methyl-N-(4-phenylbutan-2-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 4031989 |
| Molecular Formula | C29H29FN2O2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-(4-fluorophenyl)-5-(3-methoxyphenyl)-2-methyl-N-(4-phenylbutan-2-yl)pyrrole-3-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NC(C)CCc3ccccc3)c(C)n2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C29H29FN2O2/c1-20(12-13-22-8-5-4-6-9-22)31-29(33)27-19-28(23-10-7-11-26(18-23)34-3)32(21(27)2)25-16-14-24(30)15-17-25/h4-11,14-20H,12-13H2,1-3H3,(H,31,33) |
| InChIKey | HGKDNKIJNJPXSB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|