C27H24N2O3 — CID 4033545
3',3'-dimethyl-6-nitro-1'-phenyl-8-prop-2-enylspiro[chromene-2,2'-indole] (PubChem CID 4033545) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3',3'-dimethyl-6-nitro-1'-phenyl-8-prop-2-enylspiro[chromene-2,2'-indole].
| Compound Name | 3',3'-dimethyl-6-nitro-1'-phenyl-8-prop-2-enylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 4033545 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3',3'-dimethyl-6-nitro-1'-phenyl-8-prop-2-enylspiro[chromene-2,2'-indole] |
| SMILES | C=CCc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(c2ccccc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C27H24N2O3/c1-4-10-19-17-22(29(30)31)18-20-15-16-27(32-25(19)20)26(2,3)23-13-8-9-14-24(23)28(27)21-11-6-5-7-12-21/h4-9,11-18H,1,10H2,2-3H3 |
| InChIKey | QDTRJXUHJWEZGQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|