C17H12Br2N2O4S — CID 4035115
methyl 3-[[5-[(4,5-dibromofuran-2-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4035115) has the molecular formula C17H12Br2N2O4S and a molecular weight of 500.17 g/mol. Its IUPAC name is methyl 3-[[5-[(4,5-dibromofuran-2-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 3-[[5-[(4,5-dibromofuran-2-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4035115 |
| Molecular Formula | C17H12Br2N2O4S |
| Molecular Weight | 500.17 g/mol |
| Exact Mass | 497.89 |
| IUPAC Name | methyl 3-[[5-[(4,5-dibromofuran-2-yl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1cccc(/N=C2/SC(=Cc3cc(Br)c(Br)o3)C(=O)N2C)c1 |
| InChI | InChI=1S/C17H12Br2N2O4S/c1-21-15(22)13(8-11-7-12(18)14(19)25-11)26-17(21)20-10-5-3-4-9(6-10)16(23)24-2/h3-8H,1-2H3/b13-8?,20-17+ |
| InChIKey | HRBQTYNQKFVOHX-QLJMPDQJSA-N |
| XLogP | 4.82 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|