C19H22N6O3 — CID 4041000
10-methyl-5-(3,4,5-triethoxyphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4041000) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 10-methyl-5-(3,4,5-triethoxyphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-methyl-5-(3,4,5-triethoxyphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4041000 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 10-methyl-5-(3,4,5-triethoxyphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCOc1cc(-c2nnc3c4cnn(C)c4ncn23)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H22N6O3/c1-5-26-14-8-12(9-15(27-6-2)16(14)28-7-3)17-22-23-19-13-10-21-24(4)18(13)20-11-25(17)19/h8-11H,5-7H2,1-4H3 |
| InChIKey | YOFMINUCFZKDAO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |