C7H12N2O2S — CID 40505226
4-(hydroxymethyl)-3-(2-methoxyethyl)-1H-imidazole-2-thione (PubChem CID 40505226) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-(2-methoxyethyl)-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-(2-methoxyethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 40505226 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4-(hydroxymethyl)-3-(2-methoxyethyl)-1H-imidazole-2-thione |
| SMILES | COCCn1c(CO)c[nH]c1=S |
| InChI | InChI=1S/C7H12N2O2S/c1-11-3-2-9-6(5-10)4-8-7(9)12/h4,10H,2-3,5H2,1H3,(H,8,12) |
| InChIKey | LVAJVTOGZPHPFP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|