C15H12ClF3N2O3S — CID 40512676
(Z,2R)-2-(benzenesulfonyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methoxyethanimine (PubChem CID 40512676) has the molecular formula C15H12ClF3N2O3S and a molecular weight of 392.79 g/mol. Its IUPAC name is (Z,2R)-2-(benzenesulfonyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methoxyethanimine.
| Compound Name | (Z,2R)-2-(benzenesulfonyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 40512676 |
| Molecular Formula | C15H12ClF3N2O3S |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | (Z,2R)-2-(benzenesulfonyl)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-methoxyethanimine |
| SMILES | CO/N=C\[C@@H](c1ncc(C(F)(F)F)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12ClF3N2O3S/c1-24-21-9-13(25(22,23)11-5-3-2-4-6-11)14-12(16)7-10(8-20-14)15(17,18)19/h2-9,13H,1H3/b21-9-/t13-/m0/s1 |
| InChIKey | JINIHYZPNZXVIJ-YOZVVDKVSA-N |
| XLogP | 3.90 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|