C39H45F3N2O5 — CID 4051345
[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 4051345) has the molecular formula C39H45F3N2O5 and a molecular weight of 678.79 g/mol. Its IUPAC name is [5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 4051345 |
| Molecular Formula | C39H45F3N2O5 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | [5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C39H45F3N2O5/c1-34-11-8-27(45)22-36(34)14-15-38(28(23-36)32(46)25-5-3-6-26(21-25)39(40,41)42)30(34)9-12-35(2)31(38)10-13-37(35,48)24-43-16-18-44(19-17-43)33(47)29-7-4-20-49-29/h3-7,14-15,20-21,23,27,30-31,45,48H,8-13,16-19,22,24H2,1-2H3 |
| InChIKey | RVAVLMHEWJDQDW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|