C19H11Cl5N3O4S- — CID 4052450
[4-[[2-(2,3,4,5,6-pentachlorophenoxy)acetyl]amino]phenyl]sulfonyl-pyridin-2-ylazanide (PubChem CID 4052450) has the molecular formula C19H11Cl5N3O4S- and a molecular weight of 554.65 g/mol. Its IUPAC name is [4-[[2-(2,3,4,5,6-pentachlorophenoxy)acetyl]amino]phenyl]sulfonyl-pyridin-2-ylazanide.
| Compound Name | [4-[[2-(2,3,4,5,6-pentachlorophenoxy)acetyl]amino]phenyl]sulfonyl-pyridin-2-ylazanide |
|---|---|
| PubChem CID | 4052450 |
| Molecular Formula | C19H11Cl5N3O4S- |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 551.89 |
| IUPAC Name | [4-[[2-(2,3,4,5,6-pentachlorophenoxy)acetyl]amino]phenyl]sulfonyl-pyridin-2-ylazanide |
| SMILES | O=C(COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)Nc1ccc(S(=O)(=O)[N-]c2ccccn2)cc1 |
| InChI | InChI=1S/C19H12Cl5N3O4S/c20-14-15(21)17(23)19(18(24)16(14)22)31-9-13(28)26-10-4-6-11(7-5-10)32(29,30)27-12-3-1-2-8-25-12/h1-8H,9H2,(H2,25,26,27,28)/p-1 |
| InChIKey | KJKLOSUSPDHFIR-UHFFFAOYSA-M |
| XLogP | 6.76 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|