C15H20BrNO2 — CID 40544126
(3R,4R)-6-bromo-3-methyl-3-piperidin-1-yl-2,4-dihydrochromen-4-ol (PubChem CID 40544126) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is (3R,4R)-6-bromo-3-methyl-3-piperidin-1-yl-2,4-dihydrochromen-4-ol.
| Compound Name | (3R,4R)-6-bromo-3-methyl-3-piperidin-1-yl-2,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 40544126 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (3R,4R)-6-bromo-3-methyl-3-piperidin-1-yl-2,4-dihydrochromen-4-ol |
| SMILES | C[C@@]1(N2CCCCC2)COc2ccc(Br)cc2[C@H]1O |
| InChI | InChI=1S/C15H20BrNO2/c1-15(17-7-3-2-4-8-17)10-19-13-6-5-11(16)9-12(13)14(15)18/h5-6,9,14,18H,2-4,7-8,10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | NLDQZKXOEPFGRX-HUUCEWRRSA-N |
| XLogP | 3.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |