C19H14Br2N2O4 — CID 56599900
(1S,2R)-5,21-dibromo-9,17-dioxa-11,15-diazapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-3(8),4,6,18(23),19,21-hexaene-10,16-dione (PubChem CID 56599900) has the molecular formula C19H14Br2N2O4 and a molecular weight of 494.14 g/mol. Its IUPAC name is (1S,2R)-5,21-dibromo-9,17-dioxa-11,15-diazapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-3(8),4,6,18(23),19,21-hexaene-10,16-dione.
| Compound Name | (1S,2R)-5,21-dibromo-9,17-dioxa-11,15-diazapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-3(8),4,6,18(23),19,21-hexaene-10,16-dione |
|---|---|
| PubChem CID | 56599900 |
| Molecular Formula | C19H14Br2N2O4 |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 491.93 |
| IUPAC Name | (1S,2R)-5,21-dibromo-9,17-dioxa-11,15-diazapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-3(8),4,6,18(23),19,21-hexaene-10,16-dione |
| SMILES | O=C1Oc2ccc(Br)cc2[C@@H]2[C@@H]3c4cc(Br)ccc4OC(=O)N3CCCN12 |
| InChI | InChI=1S/C19H14Br2N2O4/c20-10-2-4-14-12(8-10)16-17-13-9-11(21)3-5-15(13)27-19(25)23(17)7-1-6-22(16)18(24)26-14/h2-5,8-9,16-17H,1,6-7H2/t16-,17+ |
| InChIKey | SCBWJFDFWRFJLP-CALCHBBNSA-N |
| XLogP | 5.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |