C30H22ClN5O3S — CID 4055873
[4-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate (PubChem CID 4055873) has the molecular formula C30H22ClN5O3S and a molecular weight of 568.06 g/mol. Its IUPAC name is [4-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [4-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 4055873 |
| Molecular Formula | C30H22ClN5O3S |
| Molecular Weight | 568.06 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | [4-[[[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)NN=Cc1ccc(OC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C30H22ClN5O3S/c31-24-11-7-10-23(18-24)29(38)39-26-16-14-21(15-17-26)19-32-33-27(37)20-40-30-35-34-28(22-8-3-1-4-9-22)36(30)25-12-5-2-6-13-25/h1-19H,20H2,(H,33,37) |
| InChIKey | YINYVEJZVJSWNK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.06 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|