C15H17N3S — CID 40562328
[(Z)-[phenyl-[(1S,3R,6R)-3-tricyclo[2.2.1.02,6]heptanyl]methylidene]amino]thiourea (PubChem CID 40562328) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is [(Z)-[phenyl-[(1S,3R,6R)-3-tricyclo[2.2.1.02,6]heptanyl]methylidene]amino]thiourea.
| Compound Name | [(Z)-[phenyl-[(1S,3R,6R)-3-tricyclo[2.2.1.02,6]heptanyl]methylidene]amino]thiourea |
|---|---|
| PubChem CID | 40562328 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [(Z)-[phenyl-[(1S,3R,6R)-3-tricyclo[2.2.1.02,6]heptanyl]methylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C(\c1ccccc1)[C@@H]1C2C[C@@H]3C1[C@@H]3C2 |
| InChI | InChI=1S/C15H17N3S/c16-15(19)18-17-14(8-4-2-1-3-5-8)12-9-6-10-11(7-9)13(10)12/h1-5,9-13H,6-7H2,(H3,16,18,19)/b17-14+/t9?,10-,11+,12-,13?/m1/s1 |
| InChIKey | GHRWKAIRQCQQHH-UWKWJIETSA-N |
| XLogP | 2.13 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|