C20H20N4OS2 — CID 40583723
2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole (PubChem CID 40583723) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 40583723 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]-5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole |
| SMILES | Cc1ccc2nc(CSc3nnc(-c4cc5c(s4)CC[C@@H](C)C5)o3)cn2c1 |
| InChI | InChI=1S/C20H20N4OS2/c1-12-3-5-16-14(7-12)8-17(27-16)19-22-23-20(25-19)26-11-15-10-24-9-13(2)4-6-18(24)21-15/h4,6,8-10,12H,3,5,7,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | JCMIETIRFINLFK-GFCCVEGCSA-N |
| XLogP | 5.17 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |