C20H22N2O3S2 — CID 8568869
2-[(2,5-dimethoxyphenyl)methylsulfanyl]-5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole (PubChem CID 8568869) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylsulfanyl]-5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylsulfanyl]-5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 8568869 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylsulfanyl]-5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(OC)c(CSc2nnc(-c3cc4c(s3)CC[C@H](C)C4)o2)c1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-12-4-7-17-13(8-12)10-18(27-17)19-21-22-20(25-19)26-11-14-9-15(23-2)5-6-16(14)24-3/h5-6,9-10,12H,4,7-8,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | JTCANTQMQXSYGB-LBPRGKRZSA-N |
| XLogP | 5.23 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |