C21H20N4O2S2 — CID 41113726
2-(3-methylphenyl)-5-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole (PubChem CID 41113726) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-(3-methylphenyl)-5-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-methylphenyl)-5-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 41113726 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-(3-methylphenyl)-5-[[5-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-1,3,4-oxadiazole |
| SMILES | Cc1cccc(-c2nnc(CSc3nnc(-c4cc5c(s4)CC[C@@H](C)C5)o3)o2)c1 |
| InChI | InChI=1S/C21H20N4O2S2/c1-12-4-3-5-14(8-12)19-23-22-18(26-19)11-28-21-25-24-20(27-21)17-10-15-9-13(2)6-7-16(15)29-17/h3-5,8,10,13H,6-7,9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | WQCZNBFXTHUFGA-CYBMUJFWSA-N |
| XLogP | 5.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |