C22H21N5O3S2 — CID 40953506
2-[2-[[5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-4-oxoquinazolin-3-yl]acetamide (PubChem CID 40953506) has the molecular formula C22H21N5O3S2 and a molecular weight of 467.58 g/mol. Its IUPAC name is 2-[2-[[5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-4-oxoquinazolin-3-yl]acetamide.
| Compound Name | 2-[2-[[5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-4-oxoquinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 40953506 |
| Molecular Formula | C22H21N5O3S2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[2-[[5-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-4-oxoquinazolin-3-yl]acetamide |
| SMILES | C[C@H]1CCc2sc(-c3nnc(SCc4nc5ccccc5c(=O)n4CC(N)=O)o3)cc2C1 |
| InChI | InChI=1S/C22H21N5O3S2/c1-12-6-7-16-13(8-12)9-17(32-16)20-25-26-22(30-20)31-11-19-24-15-5-3-2-4-14(15)21(29)27(19)10-18(23)28/h2-5,9,12H,6-8,10-11H2,1H3,(H2,23,28)/t12-/m0/s1 |
| InChIKey | FFQDXKQRFLRPQH-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |