C20H25N3OS — CID 40610060
1-[4-[(2R)-butan-2-yl]phenyl]-3-(3-phenylpropanoylamino)thiourea (PubChem CID 40610060) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-[4-[(2R)-butan-2-yl]phenyl]-3-(3-phenylpropanoylamino)thiourea.
| Compound Name | 1-[4-[(2R)-butan-2-yl]phenyl]-3-(3-phenylpropanoylamino)thiourea |
|---|---|
| PubChem CID | 40610060 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[4-[(2R)-butan-2-yl]phenyl]-3-(3-phenylpropanoylamino)thiourea |
| SMILES | CC[C@@H](C)c1ccc(NC(=S)NNC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N3OS/c1-3-15(2)17-10-12-18(13-11-17)21-20(25)23-22-19(24)14-9-16-7-5-4-6-8-16/h4-8,10-13,15H,3,9,14H2,1-2H3,(H,22,24)(H2,21,23,25)/t15-/m1/s1 |
| InChIKey | IBARWOSWQFSCKM-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|