C17H13N3O5S2 — CID 4064835
3-(1,3-benzodioxol-5-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 4064835) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4064835 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc2nc(NC(=O)C=Cc3ccc4c(c3)OCO4)sc2c1 |
| InChI | InChI=1S/C17H13N3O5S2/c18-27(22,23)11-3-4-12-15(8-11)26-17(19-12)20-16(21)6-2-10-1-5-13-14(7-10)25-9-24-13/h1-8H,9H2,(H2,18,22,23)(H,19,20,21) |
| InChIKey | RGPIKIWIEJKZCD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|