C22H22N2OS — CID 40648484
(5S)-7-tert-butyl-2,3-diphenyl-5H-imidazo[2,1-b][1,3]thiazin-5-ol (PubChem CID 40648484) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is (5S)-7-tert-butyl-2,3-diphenyl-5H-imidazo[2,1-b][1,3]thiazin-5-ol.
| Compound Name | (5S)-7-tert-butyl-2,3-diphenyl-5H-imidazo[2,1-b][1,3]thiazin-5-ol |
|---|---|
| PubChem CID | 40648484 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (5S)-7-tert-butyl-2,3-diphenyl-5H-imidazo[2,1-b][1,3]thiazin-5-ol |
| SMILES | CC(C)(C)C1=C[C@H](O)n2c(nc(-c3ccccc3)c2-c2ccccc2)S1 |
| InChI | InChI=1S/C22H22N2OS/c1-22(2,3)17-14-18(25)24-20(16-12-8-5-9-13-16)19(23-21(24)26-17)15-10-6-4-7-11-15/h4-14,18,25H,1-3H3/t18-/m0/s1 |
| InChIKey | KHYFLSMWMCXMEB-SFHVURJKSA-N |
| XLogP | 5.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |