C21H25N4O2S2+ — CID 4070202
N-[2-(4-phenylpiperazin-1-ium-1-yl)-2-pyridin-3-ylethyl]thiophene-2-sulfonamide (PubChem CID 4070202) has the molecular formula C21H25N4O2S2+ and a molecular weight of 429.59 g/mol. Its IUPAC name is N-[2-(4-phenylpiperazin-1-ium-1-yl)-2-pyridin-3-ylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(4-phenylpiperazin-1-ium-1-yl)-2-pyridin-3-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4070202 |
| Molecular Formula | C21H25N4O2S2+ |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[2-(4-phenylpiperazin-1-ium-1-yl)-2-pyridin-3-ylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(c1cccnc1)[NH+]1CCN(c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C21H24N4O2S2/c26-29(27,21-9-5-15-28-21)23-17-20(18-6-4-10-22-16-18)25-13-11-24(12-14-25)19-7-2-1-3-8-19/h1-10,15-16,20,23H,11-14,17H2/p+1 |
| InChIKey | RQWZVLYMKHQCFD-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |