C21H20F3N3O4S — CID 40780837
(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780837) has the molecular formula C21H20F3N3O4S and a molecular weight of 467.47 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780837 |
| Molecular Formula | C21H20F3N3O4S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-phenyl-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3ccc(OC(F)(F)F)cc3)[C@@H]21 |
| InChI | InChI=1S/C21H20F3N3O4S/c22-21(23,24)31-13-8-6-12(7-9-13)27-17-14(19(30)25-11-4-2-1-3-5-11)10-15(28)18(29)16(17)26-20(27)32/h1-9,14-18,28-29H,10H2,(H,25,30)(H,26,32)/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | VRKYRRRJBAVGJM-ZKXLYKBJSA-N |
| XLogP | 2.40 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|