C21H25F3N4O5S — CID 40780890
1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide (PubChem CID 40780890) has the molecular formula C21H25F3N4O5S and a molecular weight of 502.52 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 40780890 |
| Molecular Formula | C21H25F3N4O5S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-2-sulfanylidene-3-[4-(trifluoromethoxy)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)[C@@H]2C[C@@H](O)[C@H](O)[C@@H]3NC(=S)N(c4ccc(OC(F)(F)F)cc4)[C@@H]32)CC1 |
| InChI | InChI=1S/C21H25F3N4O5S/c22-21(23,24)33-12-3-1-11(2-4-12)28-16-13(9-14(29)17(30)15(16)26-20(28)34)19(32)27-7-5-10(6-8-27)18(25)31/h1-4,10,13-17,29-30H,5-9H2,(H2,25,31)(H,26,34)/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | AIOOKRDUSDZFFO-HHARLNAUSA-N |
| XLogP | 0.48 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|