C20H25F3N4O7 — CID 11882581
(1S,3R,4R,5S)-1,3,4-trihydroxy-N-[(3S)-2-oxopiperidin-3-yl]-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 11882581) has the molecular formula C20H25F3N4O7 and a molecular weight of 490.44 g/mol. Its IUPAC name is (1S,3R,4R,5S)-1,3,4-trihydroxy-N-[(3S)-2-oxopiperidin-3-yl]-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-1,3,4-trihydroxy-N-[(3S)-2-oxopiperidin-3-yl]-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11882581 |
| Molecular Formula | C20H25F3N4O7 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (1S,3R,4R,5S)-1,3,4-trihydroxy-N-[(3S)-2-oxopiperidin-3-yl]-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)N[C@H]1C[C@@](O)(C(=O)N[C@H]2CCCNC2=O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25F3N4O7/c21-20(22,23)34-11-5-3-10(4-6-11)25-18(32)27-13-8-19(33,9-14(28)15(13)29)17(31)26-12-2-1-7-24-16(12)30/h3-6,12-15,28-29,33H,1-2,7-9H2,(H,24,30)(H,26,31)(H2,25,27,32)/t12-,13-,14+,15+,19-/m0/s1 |
| InChIKey | WKOZTKNRMCXRMB-IDJSLIICSA-N |
| XLogP | -0.28 |
| TPSA | 169.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |