C16H18O4S — CID 40784533
(2R)-3-[(R)-(4-phenoxyphenyl)methylsulfinyl]propane-1,2-diol (PubChem CID 40784533) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (2R)-3-[(R)-(4-phenoxyphenyl)methylsulfinyl]propane-1,2-diol.
| Compound Name | (2R)-3-[(R)-(4-phenoxyphenyl)methylsulfinyl]propane-1,2-diol |
|---|---|
| PubChem CID | 40784533 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (2R)-3-[(R)-(4-phenoxyphenyl)methylsulfinyl]propane-1,2-diol |
| SMILES | O=[S@](Cc1ccc(Oc2ccccc2)cc1)C[C@H](O)CO |
| InChI | InChI=1S/C16H18O4S/c17-10-14(18)12-21(19)11-13-6-8-16(9-7-13)20-15-4-2-1-3-5-15/h1-9,14,17-18H,10-12H2/t14-,21-/m1/s1 |
| InChIKey | CVKUHFHPMZEPJA-SPLOXXLWSA-N |
| XLogP | 2.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |