C16H17NO4 — CID 71419276
N-(2,3-dihydroxypropyl)-N-(4-phenoxyphenyl)formamide (PubChem CID 71419276) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-N-(4-phenoxyphenyl)formamide.
| Compound Name | N-(2,3-dihydroxypropyl)-N-(4-phenoxyphenyl)formamide |
|---|---|
| PubChem CID | 71419276 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-N-(4-phenoxyphenyl)formamide |
| SMILES | O=CN(CC(O)CO)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO4/c18-11-14(20)10-17(12-19)13-6-8-16(9-7-13)21-15-4-2-1-3-5-15/h1-9,12,14,18,20H,10-11H2 |
| InChIKey | ZULXIOJCYRZRAH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|