C22H17NO6 — CID 57028567
2-[formyl-[(4-phenoxyphenyl)methyl]amino]terephthalic acid (PubChem CID 57028567) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is 2-[formyl-[(4-phenoxyphenyl)methyl]amino]terephthalic acid.
| Compound Name | 2-[formyl-[(4-phenoxyphenyl)methyl]amino]terephthalic acid |
|---|---|
| PubChem CID | 57028567 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[formyl-[(4-phenoxyphenyl)methyl]amino]terephthalic acid |
| SMILES | O=CN(Cc1ccc(Oc2ccccc2)cc1)c1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C22H17NO6/c24-14-23(20-12-16(21(25)26)8-11-19(20)22(27)28)13-15-6-9-18(10-7-15)29-17-4-2-1-3-5-17/h1-12,14H,13H2,(H,25,26)(H,27,28) |
| InChIKey | FQTLFNLKQDCQDT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|