C23H19NO6S2 — CID 40812214
dimethyl (7S)-2-oxo-7-(4-phenylmethoxyphenyl)-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate (PubChem CID 40812214) has the molecular formula C23H19NO6S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is dimethyl (7S)-2-oxo-7-(4-phenylmethoxyphenyl)-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate.
| Compound Name | dimethyl (7S)-2-oxo-7-(4-phenylmethoxyphenyl)-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 40812214 |
| Molecular Formula | C23H19NO6S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | dimethyl (7S)-2-oxo-7-(4-phenylmethoxyphenyl)-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](c2ccc(OCc3ccccc3)cc2)c2sc(=O)[nH]c2S1 |
| InChI | InChI=1S/C23H19NO6S2/c1-28-21(25)17-16(18-20(24-23(27)32-18)31-19(17)22(26)29-2)14-8-10-15(11-9-14)30-12-13-6-4-3-5-7-13/h3-11,16H,12H2,1-2H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | WUWGOOLUVKGKGQ-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|