C30H31NO3 — CID 40817168
(1S,2S,6R,7R)-4-cyclohexyl-1-ethyl-7-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 40817168) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4-cyclohexyl-1-ethyl-7-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2S,6R,7R)-4-cyclohexyl-1-ethyl-7-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 40817168 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (1S,2S,6R,7R)-4-cyclohexyl-1-ethyl-7-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CC[C@@]12C(=O)[C@@](C)(C(c3ccccc3)=C1c1ccccc1)[C@@H]1C(=O)N(C3CCCCC3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C30H31NO3/c1-3-30-23(20-15-9-5-10-16-20)22(19-13-7-4-8-14-19)29(2,28(30)34)24-25(30)27(33)31(26(24)32)21-17-11-6-12-18-21/h4-5,7-10,13-16,21,24-25H,3,6,11-12,17-18H2,1-2H3/t24-,25+,29-,30+/m0/s1 |
| InChIKey | GVHAYVIYXKDIQR-XLHSGLJYSA-N |
| XLogP | 5.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|