C16H22N4O5S2 — CID 40834856
(2R,4R)-4-hydroxy-1-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]pyrrolidine-2-carboxamide (PubChem CID 40834856) has the molecular formula C16H22N4O5S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-1-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-4-hydroxy-1-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 40834856 |
| Molecular Formula | C16H22N4O5S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (2R,4R)-4-hydroxy-1-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1C[C@@H](O)CN1C(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H22N4O5S2/c17-15(22)14-9-12(21)10-20(14)16(26)18-11-1-3-13(4-2-11)27(23,24)19-5-7-25-8-6-19/h1-4,12,14,21H,5-10H2,(H2,17,22)(H,18,26)/t12-,14-/m1/s1 |
| InChIKey | AWVXRQWLDAFBNX-TZMCWYRMSA-N |
| XLogP | -0.68 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|