C23H20ClN3O2S — CID 40844394
2-[2-[[(R)-(4-chlorophenyl)sulfinyl]methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 40844394) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-[2-[[(R)-(4-chlorophenyl)sulfinyl]methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[2-[[(R)-(4-chlorophenyl)sulfinyl]methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 40844394 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[2-[[(R)-(4-chlorophenyl)sulfinyl]methyl]benzimidazol-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)Cn1c(C[S@@](=O)c2ccc(Cl)cc2)nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O2S/c1-26(18-7-3-2-4-8-18)23(28)15-27-21-10-6-5-9-20(21)25-22(27)16-30(29)19-13-11-17(24)12-14-19/h2-14H,15-16H2,1H3/t30-/m1/s1 |
| InChIKey | VMGBNMKSOZCBMK-SSEXGKCCSA-N |
| XLogP | 4.66 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |