C18H15N5O4 — CID 40855424
N'-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-2-phenyltriazole-4-carbohydrazide (PubChem CID 40855424) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is N'-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-2-phenyltriazole-4-carbohydrazide.
| Compound Name | N'-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-2-phenyltriazole-4-carbohydrazide |
|---|---|
| PubChem CID | 40855424 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N'-[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-2-phenyltriazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1COc2ccccc2O1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15N5O4/c24-17(13-10-19-23(22-13)12-6-2-1-3-7-12)20-21-18(25)16-11-26-14-8-4-5-9-15(14)27-16/h1-10,16H,11H2,(H,20,24)(H,21,25)/t16-/m0/s1 |
| InChIKey | HBNMBIQTZGRUHI-INIZCTEOSA-N |
| XLogP | 0.87 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|