C30H32N2O4 — CID 4086892
N-(2-aminophenyl)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 4086892) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-(2-aminophenyl)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 4086892 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-(2-aminophenyl)-2-ethoxy-4-(9H-fluoren-1-yl)-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(=O)Nc2ccccc2N)=CC(c2cccc3c2Cc2ccccc2-3)C1CCCO |
| InChI | InChI=1S/C30H32N2O4/c1-2-35-30-23(13-8-16-33)25(18-28(36-30)29(34)32-27-15-6-5-14-26(27)31)22-12-7-11-21-20-10-4-3-9-19(20)17-24(21)22/h3-7,9-12,14-15,18,23,25,30,33H,2,8,13,16-17,31H2,1H3,(H,32,34) |
| InChIKey | SYEPWAIGWLJRQB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|