C17H15ClN3O+ — CID 4087423
N-(1H-benzimidazol-3-ium-2-ylmethyl)-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 4087423) has the molecular formula C17H15ClN3O+ and a molecular weight of 312.78 g/mol. Its IUPAC name is N-(1H-benzimidazol-3-ium-2-ylmethyl)-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-(1H-benzimidazol-3-ium-2-ylmethyl)-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4087423 |
| Molecular Formula | C17H15ClN3O+ |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(1H-benzimidazol-3-ium-2-ylmethyl)-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NCc1[nH]c2ccccc2[nH+]1 |
| InChI | InChI=1S/C17H14ClN3O/c18-13-6-2-1-5-12(13)9-10-17(22)19-11-16-20-14-7-3-4-8-15(14)21-16/h1-10H,11H2,(H,19,22)(H,20,21)/p+1 |
| InChIKey | KRBIMNHTRXGOPD-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|