C26H27N7O3 — CID 40921603
(E)-1-(3,4-dimethoxyphenyl)-N-[[11,12-dimethyl-10-(pyridin-3-ylmethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]ethanimine (PubChem CID 40921603) has the molecular formula C26H27N7O3 and a molecular weight of 485.55 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-N-[[11,12-dimethyl-10-(pyridin-3-ylmethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]ethanimine.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-N-[[11,12-dimethyl-10-(pyridin-3-ylmethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]ethanimine |
|---|---|
| PubChem CID | 40921603 |
| Molecular Formula | C26H27N7O3 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-N-[[11,12-dimethyl-10-(pyridin-3-ylmethyl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]ethanimine |
| SMILES | COc1ccc(/C(C)=N/OCc2nc3c4c(C)c(C)n(Cc5cccnc5)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C26H27N7O3/c1-16-18(3)32(13-19-7-6-10-27-12-19)25-24(16)26-29-23(30-33(26)15-28-25)14-36-31-17(2)20-8-9-21(34-4)22(11-20)35-5/h6-12,15H,13-14H2,1-5H3/b31-17+ |
| InChIKey | MKJSAAPWWISSIV-KBVAKVRCSA-N |
| XLogP | 4.10 |
| TPSA | 100.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|