C16H17FN4O3S3 — CID 40974834
(2R)-1-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 40974834) has the molecular formula C16H17FN4O3S3 and a molecular weight of 428.54 g/mol. Its IUPAC name is (2R)-1-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 40974834 |
| Molecular Formula | C16H17FN4O3S3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | (2R)-1-(2-fluorophenyl)sulfonyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | C=CCSc1nnc(NC(=O)[C@H]2CCCN2S(=O)(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C16H17FN4O3S3/c1-2-10-25-16-20-19-15(26-16)18-14(22)12-7-5-9-21(12)27(23,24)13-8-4-3-6-11(13)17/h2-4,6,8,12H,1,5,7,9-10H2,(H,18,19,22)/t12-/m1/s1 |
| InChIKey | OVHHYWSLXDVLMZ-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|